C46H22 — CID 140707297
1,4-bis[2,3-diethynyl-4-(2-ethynylphenyl)phenyl]-2,3-diethynylbenzene (PubChem CID 140707297) has the molecular formula C46H22 and a molecular weight of 574.68 g/mol. Its IUPAC name is 1,4-bis[2,3-diethynyl-4-(2-ethynylphenyl)phenyl]-2,3-diethynylbenzene.
| Compound Name | 1,4-bis[2,3-diethynyl-4-(2-ethynylphenyl)phenyl]-2,3-diethynylbenzene |
|---|---|
| PubChem CID | 140707297 |
| Molecular Formula | C46H22 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 1,4-bis[2,3-diethynyl-4-(2-ethynylphenyl)phenyl]-2,3-diethynylbenzene |
| SMILES | C#Cc1ccccc1-c1ccc(-c2ccc(-c3ccc(-c4ccccc4C#C)c(C#C)c3C#C)c(C#C)c2C#C)c(C#C)c1C#C |
| InChI | InChI=1S/C46H22/c1-9-31-21-17-19-23-39(31)41-25-27-43(35(13-5)33(41)11-3)45-29-30-46(38(16-8)37(45)15-7)44-28-26-42(34(12-4)36(44)14-6)40-24-20-18-22-32(40)10-2/h1-8,17-30H |
| InChIKey | IBPARPAEOKVUOP-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|