C50H46N2 — CID 140711456
N-[3-(6-tert-butyl-9-phenylcarbazol-3-yl)phenyl]-N-[(2E,6Z)-4,5-dimethylideneocta-2,6-dien-2-yl]-3-phenylaniline (PubChem CID 140711456) has the molecular formula C50H46N2 and a molecular weight of 674.93 g/mol. Its IUPAC name is N-[3-(6-tert-butyl-9-phenylcarbazol-3-yl)phenyl]-N-[(2E,6Z)-4,5-dimethylideneocta-2,6-dien-2-yl]-3-phenylaniline.
| Compound Name | N-[3-(6-tert-butyl-9-phenylcarbazol-3-yl)phenyl]-N-[(2E,6Z)-4,5-dimethylideneocta-2,6-dien-2-yl]-3-phenylaniline |
|---|---|
| PubChem CID | 140711456 |
| Molecular Formula | C50H46N2 |
| Molecular Weight | 674.93 g/mol |
| Exact Mass | 674.37 |
| IUPAC Name | N-[3-(6-tert-butyl-9-phenylcarbazol-3-yl)phenyl]-N-[(2E,6Z)-4,5-dimethylideneocta-2,6-dien-2-yl]-3-phenylaniline |
| SMILES | C=C(/C=C\C)C(=C)/C=C(\C)N(c1cccc(-c2ccccc2)c1)c1cccc(-c2ccc3c(c2)c2cc(C(C)(C)C)ccc2n3-c2ccccc2)c1 |
| InChI | InChI=1S/C50H46N2/c1-8-17-35(2)36(3)30-37(4)51(44-24-15-20-39(31-44)38-18-11-9-12-19-38)45-25-16-21-40(32-45)41-26-28-48-46(33-41)47-34-42(50(5,6)7)27-29-49(47)52(48)43-22-13-10-14-23-43/h8-34H,2-3H2,1,4-7H3/b17-8-,37-30+ |
| InChIKey | QDTQVCPMURQSDL-XSFYNYTESA-N |
| XLogP | 14.15 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.93 |
| LogP ≤ 5 | 14.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|