C19H17F2NO2 — CID 140712329
[(3R,4R)-4-cyano-3-(2,6-difluorophenyl)-4-phenylbutyl] acetate (PubChem CID 140712329) has the molecular formula C19H17F2NO2 and a molecular weight of 329.35 g/mol. Its IUPAC name is [(3R,4R)-4-cyano-3-(2,6-difluorophenyl)-4-phenylbutyl] acetate.
| Compound Name | [(3R,4R)-4-cyano-3-(2,6-difluorophenyl)-4-phenylbutyl] acetate |
|---|---|
| PubChem CID | 140712329 |
| Molecular Formula | C19H17F2NO2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | [(3R,4R)-4-cyano-3-(2,6-difluorophenyl)-4-phenylbutyl] acetate |
| SMILES | CC(=O)OCC[C@@H](c1c(F)cccc1F)[C@@H](C#N)c1ccccc1 |
| InChI | InChI=1S/C19H17F2NO2/c1-13(23)24-11-10-15(19-17(20)8-5-9-18(19)21)16(12-22)14-6-3-2-4-7-14/h2-9,15-16H,10-11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | YJETWWSXPJSRDV-CVEARBPZSA-N |
| XLogP | 4.31 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |