C24H21NO4 — CID 1407155
[4-(phenylcarbamoyl)phenyl] 2-(2-prop-2-enylphenoxy)acetate (PubChem CID 1407155) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is [4-(phenylcarbamoyl)phenyl] 2-(2-prop-2-enylphenoxy)acetate.
| Compound Name | [4-(phenylcarbamoyl)phenyl] 2-(2-prop-2-enylphenoxy)acetate |
|---|---|
| PubChem CID | 1407155 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [4-(phenylcarbamoyl)phenyl] 2-(2-prop-2-enylphenoxy)acetate |
| SMILES | C=CCc1ccccc1OCC(=O)Oc1ccc(C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO4/c1-2-8-18-9-6-7-12-22(18)28-17-23(26)29-21-15-13-19(14-16-21)24(27)25-20-10-4-3-5-11-20/h2-7,9-16H,1,8,17H2,(H,25,27) |
| InChIKey | GZCSHMLQGIQFDR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|