C15H11ClFN3O — CID 140719321
1-(10-chloro-6-fluoro-8-isocyano-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-2-yl)ethanone (PubChem CID 140719321) has the molecular formula C15H11ClFN3O and a molecular weight of 303.72 g/mol. Its IUPAC name is 1-(10-chloro-6-fluoro-8-isocyano-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-2-yl)ethanone.
| Compound Name | 1-(10-chloro-6-fluoro-8-isocyano-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-2-yl)ethanone |
|---|---|
| PubChem CID | 140719321 |
| Molecular Formula | C15H11ClFN3O |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 1-(10-chloro-6-fluoro-8-isocyano-3,4-dihydro-1H-benzo[b][1,6]naphthyridin-2-yl)ethanone |
| SMILES | [C-]#[N+]c1cc(F)c2nc3c(c(Cl)c2c1)CN(C(C)=O)CC3 |
| InChI | InChI=1S/C15H11ClFN3O/c1-8(21)20-4-3-13-11(7-20)14(16)10-5-9(18-2)6-12(17)15(10)19-13/h5-6H,3-4,7H2,1H3 |
| InChIKey | ATAWIQZPIXTTDR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|