C10H10ClN3O — CID 59369476
CID 59369476 (PubChem CID 59369476) has the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol.
| Compound Name | CID 59369476 |
|---|---|
| PubChem CID | 59369476 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | — |
| SMILES | [CH]c1nc(Cl)nc2c1CN(C(C)=O)CC2 |
| InChI | InChI=1S/C10H10ClN3O/c1-6-8-5-14(7(2)15)4-3-9(8)13-10(11)12-6/h1H,3-5H2,2H3 |
| InChIKey | IIGWXYUQLUJUPL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |