About 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate
1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate (PubChem CID 19883212) has the molecular formula C15H18N4O2
and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate.
Molecular Properties
| Compound Name | 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate |
| PubChem CID | 19883212 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate |
| SMILES | CC(=O)N1CCc2nc(N)nc(-c3ccccc3)c2C1.O |
| InChI | InChI=1S/C15H16N4O.H2O/c1-10(20)19-8-7-13-12(9-19)14(18-15(16)17-13)11-5-3-2-4-6-11;/h2-6H,7-9H2,1H3,(H2,16,17,18);1H2 |
| InChIKey | YETIOKDZKHNIQJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate?
The IUPAC name of 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate (CID 19883212) is 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate.
What is the SMILES notation for 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate?
The canonical SMILES for 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate is CC(=O)N1CCc2nc(N)nc(-c3ccccc3)c2C1.O.
What is the InChIKey of 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate?
The InChIKey is YETIOKDZKHNIQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O.H2O/c1-10(20)19-8-7-13-12(9-19)14(18-15(16)17-13)11-5-3-2-4-6-11;/h2-6H,7-9H2,1H3,(H2,16,17,18);1H2.
What are the key properties of 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate?
1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate has a molecular weight of 286.33 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-4-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)ethanone;hydrate is sourced from PubChem (CID 19883212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).