C14H16N4OS — CID 167585382
1-(4-methyl-5-thia-3,9,10,14-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(16),2(6),3,10-tetraen-14-yl)ethanone (PubChem CID 167585382) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 1-(4-methyl-5-thia-3,9,10,14-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(16),2(6),3,10-tetraen-14-yl)ethanone.
| Compound Name | 1-(4-methyl-5-thia-3,9,10,14-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(16),2(6),3,10-tetraen-14-yl)ethanone |
|---|---|
| PubChem CID | 167585382 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-(4-methyl-5-thia-3,9,10,14-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(16),2(6),3,10-tetraen-14-yl)ethanone |
| SMILES | CC(=O)N1CCc2nn3c(c2C1)-c1nc(C)sc1CC3 |
| InChI | InChI=1S/C14H16N4OS/c1-8-15-13-12(20-8)4-6-18-14(13)10-7-17(9(2)19)5-3-11(10)16-18/h3-7H2,1-2H3 |
| InChIKey | HSPYEWBXSKJPMD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |