C12H14N4O4 — CID 146625439
13-methyl-11,14-dioxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylic acid (PubChem CID 146625439) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 13-methyl-11,14-dioxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylic acid.
| Compound Name | 13-methyl-11,14-dioxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylic acid |
|---|---|
| PubChem CID | 146625439 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 13-methyl-11,14-dioxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylic acid |
| SMILES | CN1CC(=O)Cn2nc3c(c2C1=O)CN(C(=O)O)CC3 |
| InChI | InChI=1S/C12H14N4O4/c1-14-4-7(17)5-16-10(11(14)18)8-6-15(12(19)20)3-2-9(8)13-16/h2-6H2,1H3,(H,19,20) |
| InChIKey | MSDYPUACOKMHSU-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |