C13H18N4O3 — CID 166657602
methyl 4,12-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-5-carboxylate (PubChem CID 166657602) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is methyl 4,12-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-5-carboxylate.
| Compound Name | methyl 4,12-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-5-carboxylate |
|---|---|
| PubChem CID | 166657602 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | methyl 4,12-dimethyl-3-oxo-4,7,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1,8-diene-5-carboxylate |
| SMILES | COC(=O)C1Cn2nc3c(c2C(=O)N1C)CN(C)CC3 |
| InChI | InChI=1S/C13H18N4O3/c1-15-5-4-9-8(6-15)11-12(18)16(2)10(13(19)20-3)7-17(11)14-9/h10H,4-7H2,1-3H3 |
| InChIKey | ADWLWNURDVMDJH-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |