C10H12N2OS — CID 169135165
1-(2-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl)prop-2-en-1-one (PubChem CID 169135165) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 1-(2-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl)prop-2-en-1-one.
| Compound Name | 1-(2-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 169135165 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 1-(2-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2sc(C)nc2C1 |
| InChI | InChI=1S/C10H12N2OS/c1-3-10(13)12-5-4-9-8(6-12)11-7(2)14-9/h3H,1,4-6H2,2H3 |
| InChIKey | FUUPUYJEOHNNHD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|