C18H25N3O2S — CID 166411092
N-methyl-1-prop-2-enoyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 166411092) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-methyl-1-prop-2-enoyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | N-methyl-1-prop-2-enoyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 166411092 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-methyl-1-prop-2-enoyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(C(=O)N(C)Cc2nc3c(s2)CCCC3)CC1 |
| InChI | InChI=1S/C18H25N3O2S/c1-3-17(22)21-10-8-13(9-11-21)18(23)20(2)12-16-19-14-6-4-5-7-15(14)24-16/h3,13H,1,4-12H2,2H3 |
| InChIKey | VOQOZTYEOSENKW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|