C42H82O2Si4 — CID 140720716
tricyclohexyl-[2-[dimethyl(tricyclohexylsilyloxy)silyl]ethyl-dimethylsilyl]oxysilane (PubChem CID 140720716) has the molecular formula C42H82O2Si4 and a molecular weight of 731.46 g/mol. Its IUPAC name is tricyclohexyl-[2-[dimethyl(tricyclohexylsilyloxy)silyl]ethyl-dimethylsilyl]oxysilane.
| Compound Name | tricyclohexyl-[2-[dimethyl(tricyclohexylsilyloxy)silyl]ethyl-dimethylsilyl]oxysilane |
|---|---|
| PubChem CID | 140720716 |
| Molecular Formula | C42H82O2Si4 |
| Molecular Weight | 731.46 g/mol |
| Exact Mass | 730.54 |
| IUPAC Name | tricyclohexyl-[2-[dimethyl(tricyclohexylsilyloxy)silyl]ethyl-dimethylsilyl]oxysilane |
| SMILES | C[Si](C)(CC[Si](C)(C)O[Si](C1CCCCC1)(C1CCCCC1)C1CCCCC1)O[Si](C1CCCCC1)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C42H82O2Si4/c1-45(2,43-47(37-23-11-5-12-24-37,38-25-13-6-14-26-38)39-27-15-7-16-28-39)35-36-46(3,4)44-48(40-29-17-8-18-30-40,41-31-19-9-20-32-41)42-33-21-10-22-34-42/h37-42H,5-36H2,1-4H3 |
| InChIKey | WEFHFLCAUAROOT-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.46 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|