C12H29NOSi2 — CID 140721743
6-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)hexan-1-ol (PubChem CID 140721743) has the molecular formula C12H29NOSi2 and a molecular weight of 259.54 g/mol. Its IUPAC name is 6-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)hexan-1-ol.
| Compound Name | 6-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)hexan-1-ol |
|---|---|
| PubChem CID | 140721743 |
| Molecular Formula | C12H29NOSi2 |
| Molecular Weight | 259.54 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 6-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)hexan-1-ol |
| SMILES | C[Si]1(C)CC[Si](C)(C)N1CCCCCCO |
| InChI | InChI=1S/C12H29NOSi2/c1-15(2)11-12-16(3,4)13(15)9-7-5-6-8-10-14/h14H,5-12H2,1-4H3 |
| InChIKey | BFFCGJLCLQMFHZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|