C20H16N4O — CID 140721848
4-(1-benzyl-3-isocyanopyrrolo[3,2-b]pyridin-6-yl)-3,5-dimethyl-1,2-oxazole (PubChem CID 140721848) has the molecular formula C20H16N4O and a molecular weight of 328.38 g/mol. Its IUPAC name is 4-(1-benzyl-3-isocyanopyrrolo[3,2-b]pyridin-6-yl)-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-(1-benzyl-3-isocyanopyrrolo[3,2-b]pyridin-6-yl)-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 140721848 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 4-(1-benzyl-3-isocyanopyrrolo[3,2-b]pyridin-6-yl)-3,5-dimethyl-1,2-oxazole |
| SMILES | [C-]#[N+]c1cn(Cc2ccccc2)c2cc(-c3c(C)noc3C)cnc12 |
| InChI | InChI=1S/C20H16N4O/c1-13-19(14(2)25-23-13)16-9-18-20(22-10-16)17(21-3)12-24(18)11-15-7-5-4-6-8-15/h4-10,12H,11H2,1-2H3 |
| InChIKey | BAFSKTOJNGPMIX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 48.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|