C28H29FN4O5 — CID 140723038
[fluoro-[5-(4-morpholin-4-yl-6-oxo-1H-pyridin-2-yl)-9H-xanthen-2-yl]amino] piperidine-1-carboxylate (PubChem CID 140723038) has the molecular formula C28H29FN4O5 and a molecular weight of 520.56 g/mol. Its IUPAC name is [fluoro-[5-(4-morpholin-4-yl-6-oxo-1H-pyridin-2-yl)-9H-xanthen-2-yl]amino] piperidine-1-carboxylate.
| Compound Name | [fluoro-[5-(4-morpholin-4-yl-6-oxo-1H-pyridin-2-yl)-9H-xanthen-2-yl]amino] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140723038 |
| Molecular Formula | C28H29FN4O5 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [fluoro-[5-(4-morpholin-4-yl-6-oxo-1H-pyridin-2-yl)-9H-xanthen-2-yl]amino] piperidine-1-carboxylate |
| SMILES | O=C(ON(F)c1ccc2c(c1)Cc1cccc(-c3cc(N4CCOCC4)cc(=O)[nH]3)c1O2)N1CCCCC1 |
| InChI | InChI=1S/C28H29FN4O5/c29-33(38-28(35)32-9-2-1-3-10-32)21-7-8-25-20(16-21)15-19-5-4-6-23(27(19)37-25)24-17-22(18-26(34)30-24)31-11-13-36-14-12-31/h4-8,16-18H,1-3,9-15H2,(H,30,34) |
| InChIKey | CEGWCEGZWBRBST-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|