C27H29FN4O3 — CID 121395241
6-[3-fluoro-7-(piperidin-4-ylamino)-9H-xanthen-4-yl]-4-morpholin-4-yl-1H-pyridin-2-one (PubChem CID 121395241) has the molecular formula C27H29FN4O3 and a molecular weight of 476.55 g/mol. Its IUPAC name is 6-[3-fluoro-7-(piperidin-4-ylamino)-9H-xanthen-4-yl]-4-morpholin-4-yl-1H-pyridin-2-one.
| Compound Name | 6-[3-fluoro-7-(piperidin-4-ylamino)-9H-xanthen-4-yl]-4-morpholin-4-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 121395241 |
| Molecular Formula | C27H29FN4O3 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 6-[3-fluoro-7-(piperidin-4-ylamino)-9H-xanthen-4-yl]-4-morpholin-4-yl-1H-pyridin-2-one |
| SMILES | O=c1cc(N2CCOCC2)cc(-c2c(F)ccc3c2Oc2ccc(NC4CCNCC4)cc2C3)[nH]1 |
| InChI | InChI=1S/C27H29FN4O3/c28-22-3-1-17-13-18-14-20(30-19-5-7-29-8-6-19)2-4-24(18)35-27(17)26(22)23-15-21(16-25(33)31-23)32-9-11-34-12-10-32/h1-4,14-16,19,29-30H,5-13H2,(H,31,33) |
| InChIKey | MCZFCGPUCRGNEX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |