C23H29FN4O2 — CID 22580825
1-(3,4-dihydro-2H-chromen-3-yl)-3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]urea (PubChem CID 22580825) has the molecular formula C23H29FN4O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-3-yl)-3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]urea.
| Compound Name | 1-(3,4-dihydro-2H-chromen-3-yl)-3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 22580825 |
| Molecular Formula | C23H29FN4O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-3-yl)-3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]urea |
| SMILES | O=C(NCCCN1CCN(c2ccccc2F)CC1)NC1COc2ccccc2C1 |
| InChI | InChI=1S/C23H29FN4O2/c24-20-7-2-3-8-21(20)28-14-12-27(13-15-28)11-5-10-25-23(29)26-19-16-18-6-1-4-9-22(18)30-17-19/h1-4,6-9,19H,5,10-17H2,(H2,25,26,29) |
| InChIKey | RVIZXVQFEITBCS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|