C34H52O12 — CID 140723109
1-O-butyl 4-O-(2-methylhexan-3-yl) (E)-3-[(E)-4-[(E)-1,4-dibutoxy-1,4-dioxobut-2-en-2-yl]oxy-4-oxobut-2-enoyl]oxy-2-propan-2-ylbut-2-enedioate (PubChem CID 140723109) has the molecular formula C34H52O12 and a molecular weight of 652.78 g/mol. Its IUPAC name is 1-O-butyl 4-O-(2-methylhexan-3-yl) (E)-3-[(E)-4-[(E)-1,4-dibutoxy-1,4-dioxobut-2-en-2-yl]oxy-4-oxobut-2-enoyl]oxy-2-propan-2-ylbut-2-enedioate.
| Compound Name | 1-O-butyl 4-O-(2-methylhexan-3-yl) (E)-3-[(E)-4-[(E)-1,4-dibutoxy-1,4-dioxobut-2-en-2-yl]oxy-4-oxobut-2-enoyl]oxy-2-propan-2-ylbut-2-enedioate |
|---|---|
| PubChem CID | 140723109 |
| Molecular Formula | C34H52O12 |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | 1-O-butyl 4-O-(2-methylhexan-3-yl) (E)-3-[(E)-4-[(E)-1,4-dibutoxy-1,4-dioxobut-2-en-2-yl]oxy-4-oxobut-2-enoyl]oxy-2-propan-2-ylbut-2-enedioate |
| SMILES | CCCCOC(=O)/C=C(/OC(=O)/C=C/C(=O)O/C(C(=O)OC(CCC)C(C)C)=C(/C(=O)OCCCC)C(C)C)C(=O)OCCCC |
| InChI | InChI=1S/C34H52O12/c1-9-13-19-41-29(37)22-26(32(38)42-20-14-10-2)44-27(35)17-18-28(36)46-31(34(40)45-25(16-12-4)23(5)6)30(24(7)8)33(39)43-21-15-11-3/h17-18,22-25H,9-16,19-21H2,1-8H3/b18-17+,26-22+,31-30+ |
| InChIKey | HOQDCNLXQKTTFU-SBSWTQARSA-N |
| XLogP | 5.82 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|