C26H36O12 — CID 140723107
1-O-ethyl 4-O-(3-methylbutan-2-yl) (E)-3-[(E)-4-[(E)-1,4-diethoxy-1,4-dioxobut-2-en-2-yl]oxy-4-oxobut-2-enoyl]oxy-2-propan-2-ylbut-2-enedioate (PubChem CID 140723107) has the molecular formula C26H36O12 and a molecular weight of 540.56 g/mol. Its IUPAC name is 1-O-ethyl 4-O-(3-methylbutan-2-yl) (E)-3-[(E)-4-[(E)-1,4-diethoxy-1,4-dioxobut-2-en-2-yl]oxy-4-oxobut-2-enoyl]oxy-2-propan-2-ylbut-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-(3-methylbutan-2-yl) (E)-3-[(E)-4-[(E)-1,4-diethoxy-1,4-dioxobut-2-en-2-yl]oxy-4-oxobut-2-enoyl]oxy-2-propan-2-ylbut-2-enedioate |
|---|---|
| PubChem CID | 140723107 |
| Molecular Formula | C26H36O12 |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 1-O-ethyl 4-O-(3-methylbutan-2-yl) (E)-3-[(E)-4-[(E)-1,4-diethoxy-1,4-dioxobut-2-en-2-yl]oxy-4-oxobut-2-enoyl]oxy-2-propan-2-ylbut-2-enedioate |
| SMILES | CCOC(=O)/C=C(/OC(=O)/C=C/C(=O)O/C(C(=O)OC(C)C(C)C)=C(/C(=O)OCC)C(C)C)C(=O)OCC |
| InChI | InChI=1S/C26H36O12/c1-9-33-21(29)14-18(24(30)34-10-2)37-19(27)12-13-20(28)38-23(26(32)36-17(8)15(4)5)22(16(6)7)25(31)35-11-3/h12-17H,9-11H2,1-8H3/b13-12+,18-14+,23-22+ |
| InChIKey | RNSRJQYDRISUPJ-GNWOBNBISA-N |
| XLogP | 2.70 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|