C13H16O5 — CID 123219782
(4-methyl-2-oxooxolan-3-yl) 6-methoxy-4-methylidenehexa-2,5-dienoate (PubChem CID 123219782) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (4-methyl-2-oxooxolan-3-yl) 6-methoxy-4-methylidenehexa-2,5-dienoate.
| Compound Name | (4-methyl-2-oxooxolan-3-yl) 6-methoxy-4-methylidenehexa-2,5-dienoate |
|---|---|
| PubChem CID | 123219782 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (4-methyl-2-oxooxolan-3-yl) 6-methoxy-4-methylidenehexa-2,5-dienoate |
| SMILES | C=C(C=COC)C=CC(=O)OC1C(=O)OCC1C |
| InChI | InChI=1S/C13H16O5/c1-9(6-7-16-3)4-5-11(14)18-12-10(2)8-17-13(12)15/h4-7,10,12H,1,8H2,2-3H3 |
| InChIKey | OLPICCWFZGZQEF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|