C16H24O4 — CID 142266326
ethyl (2E,4E,6Z)-2,6-dimethyl-5-(oxolan-3-yloxy)octa-2,4,6-trienoate (PubChem CID 142266326) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is ethyl (2E,4E,6Z)-2,6-dimethyl-5-(oxolan-3-yloxy)octa-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6Z)-2,6-dimethyl-5-(oxolan-3-yloxy)octa-2,4,6-trienoate |
|---|---|
| PubChem CID | 142266326 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | ethyl (2E,4E,6Z)-2,6-dimethyl-5-(oxolan-3-yloxy)octa-2,4,6-trienoate |
| SMILES | C/C=C(C)\C(=C/C=C(\C)C(=O)OCC)OC1CCOC1 |
| InChI | InChI=1S/C16H24O4/c1-5-12(3)15(20-14-9-10-18-11-14)8-7-13(4)16(17)19-6-2/h5,7-8,14H,6,9-11H2,1-4H3/b12-5-,13-7+,15-8+ |
| InChIKey | IKHHEZDSRBGWPT-AFCZAZDISA-N |
| XLogP | 3.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|