C14H18O4 — CID 144509449
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 4-methylcyclohexa-1,4-diene-1-carboxylate (PubChem CID 144509449) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 4-methylcyclohexa-1,4-diene-1-carboxylate.
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 4-methylcyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 144509449 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 4-methylcyclohexa-1,4-diene-1-carboxylate |
| SMILES | CC1=CCC(C(=O)O[C@H]2C(=O)OCC2(C)C)=CC1 |
| InChI | InChI=1S/C14H18O4/c1-9-4-6-10(7-5-9)12(15)18-11-13(16)17-8-14(11,2)3/h4,7,11H,5-6,8H2,1-3H3/t11-/m0/s1 |
| InChIKey | FGVFNZLQKTWNHO-NSHDSACASA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|