C14H21FO4 — CID 101176682
[(3S)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-4-ethyl-2-fluorohex-2-enoate (PubChem CID 101176682) has the molecular formula C14H21FO4 and a molecular weight of 272.32 g/mol. Its IUPAC name is [(3S)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-4-ethyl-2-fluorohex-2-enoate.
| Compound Name | [(3S)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-4-ethyl-2-fluorohex-2-enoate |
|---|---|
| PubChem CID | 101176682 |
| Molecular Formula | C14H21FO4 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | [(3S)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-4-ethyl-2-fluorohex-2-enoate |
| SMILES | CCC(/C=C(/F)C(=O)O[C@@H]1C(=O)OCC1(C)C)CC |
| InChI | InChI=1S/C14H21FO4/c1-5-9(6-2)7-10(15)12(16)19-11-13(17)18-8-14(11,3)4/h7,9,11H,5-6,8H2,1-4H3/b10-7+/t11-/m1/s1 |
| InChIKey | IEBFNPYZEATXSI-PFEDMVJOSA-N |
| XLogP | 2.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|