C13H18O4 — CID 11736555
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2E)-4-methylhexa-2,5-dienoate (PubChem CID 11736555) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2E)-4-methylhexa-2,5-dienoate.
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2E)-4-methylhexa-2,5-dienoate |
|---|---|
| PubChem CID | 11736555 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2E)-4-methylhexa-2,5-dienoate |
| SMILES | C=CC(C)/C=C/C(=O)O[C@H]1C(=O)OCC1(C)C |
| InChI | InChI=1S/C13H18O4/c1-5-9(2)6-7-10(14)17-11-12(15)16-8-13(11,3)4/h5-7,9,11H,1,8H2,2-4H3/b7-6+/t9?,11-/m0/s1 |
| InChIKey | YUJLSQZCBXBFDN-KYUKNKHNSA-N |
| XLogP | 1.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|