C17H24O5 — CID 10935740
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (6R)-6-butoxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 10935740) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (6R)-6-butoxycyclohexa-1,3-diene-1-carboxylate.
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (6R)-6-butoxycyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 10935740 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (6R)-6-butoxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | CCCCO[C@@H]1CC=CC=C1C(=O)O[C@H]1C(=O)OCC1(C)C |
| InChI | InChI=1S/C17H24O5/c1-4-5-10-20-13-9-7-6-8-12(13)15(18)22-14-16(19)21-11-17(14,2)3/h6-8,13-14H,4-5,9-11H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | GPWTUHBKVYILJI-KGLIPLIRSA-N |
| XLogP | 2.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|