C17H18O7 — CID 134924432
dimethyl 8-tert-butyl-2,6-dioxo-1-oxaspiro[4.5]deca-3,7,9-triene-3,4-dicarboxylate (PubChem CID 134924432) has the molecular formula C17H18O7 and a molecular weight of 334.32 g/mol. Its IUPAC name is dimethyl 8-tert-butyl-2,6-dioxo-1-oxaspiro[4.5]deca-3,7,9-triene-3,4-dicarboxylate.
| Compound Name | dimethyl 8-tert-butyl-2,6-dioxo-1-oxaspiro[4.5]deca-3,7,9-triene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 134924432 |
| Molecular Formula | C17H18O7 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | dimethyl 8-tert-butyl-2,6-dioxo-1-oxaspiro[4.5]deca-3,7,9-triene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C=CC(C(C)(C)C)=CC2=O)OC1=O |
| InChI | InChI=1S/C17H18O7/c1-16(2,3)9-6-7-17(10(18)8-9)12(15(21)23-5)11(13(19)22-4)14(20)24-17/h6-8H,1-5H3 |
| InChIKey | FLGCRRNHMVGUPV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|