C18H26O5 — CID 166126811
ethyl 5-[(1E,3E)-hexa-1,3-dienyl]-2-(2-methoxypropyl)-5-methyl-4-oxofuran-3-carboxylate (PubChem CID 166126811) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is ethyl 5-[(1E,3E)-hexa-1,3-dienyl]-2-(2-methoxypropyl)-5-methyl-4-oxofuran-3-carboxylate.
| Compound Name | ethyl 5-[(1E,3E)-hexa-1,3-dienyl]-2-(2-methoxypropyl)-5-methyl-4-oxofuran-3-carboxylate |
|---|---|
| PubChem CID | 166126811 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | ethyl 5-[(1E,3E)-hexa-1,3-dienyl]-2-(2-methoxypropyl)-5-methyl-4-oxofuran-3-carboxylate |
| SMILES | CC/C=C/C=C/C1(C)OC(CC(C)OC)=C(C(=O)OCC)C1=O |
| InChI | InChI=1S/C18H26O5/c1-6-8-9-10-11-18(4)16(19)15(17(20)22-7-2)14(23-18)12-13(3)21-5/h8-11,13H,6-7,12H2,1-5H3/b9-8+,11-10+ |
| InChIKey | UWUXLGUZIKHIDL-BNFZFUHLSA-N |
| XLogP | 3.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|