C16H24O5 — CID 156581009
methyl (5R)-5-[(E,5R)-5-hydroxyhex-1-enyl]-5-methyl-4-oxo-2-propylfuran-3-carboxylate (PubChem CID 156581009) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is methyl (5R)-5-[(E,5R)-5-hydroxyhex-1-enyl]-5-methyl-4-oxo-2-propylfuran-3-carboxylate.
| Compound Name | methyl (5R)-5-[(E,5R)-5-hydroxyhex-1-enyl]-5-methyl-4-oxo-2-propylfuran-3-carboxylate |
|---|---|
| PubChem CID | 156581009 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | methyl (5R)-5-[(E,5R)-5-hydroxyhex-1-enyl]-5-methyl-4-oxo-2-propylfuran-3-carboxylate |
| SMILES | CCCC1=C(C(=O)OC)C(=O)[C@@](C)(/C=C/CC[C@@H](C)O)O1 |
| InChI | InChI=1S/C16H24O5/c1-5-8-12-13(15(19)20-4)14(18)16(3,21-12)10-7-6-9-11(2)17/h7,10-11,17H,5-6,8-9H2,1-4H3/b10-7+/t11-,16-/m1/s1 |
| InChIKey | IBWFNBAINSITIL-HVBJOVIZSA-N |
| XLogP | 2.29 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|