C14H20O5 — CID 162650435
methyl (5R)-5-[(E,5S)-5-hydroxyhex-1-enyl]-2,5-dimethyl-4-oxofuran-3-carboxylate (PubChem CID 162650435) has the molecular formula C14H20O5 and a molecular weight of 268.30 g/mol. Its IUPAC name is methyl (5R)-5-[(E,5S)-5-hydroxyhex-1-enyl]-2,5-dimethyl-4-oxofuran-3-carboxylate.
| Compound Name | methyl (5R)-5-[(E,5S)-5-hydroxyhex-1-enyl]-2,5-dimethyl-4-oxofuran-3-carboxylate |
|---|---|
| PubChem CID | 162650435 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | methyl (5R)-5-[(E,5S)-5-hydroxyhex-1-enyl]-2,5-dimethyl-4-oxofuran-3-carboxylate |
| SMILES | CC1=C(C(=O)[C@@](O1)(C)/C=C/CC[C@H](C)O)C(=O)OC |
| InChI | InChI=1S/C14H20O5/c1-9(15)7-5-6-8-14(3)12(16)11(10(2)19-14)13(17)18-4/h6,8-9,15H,5,7H2,1-4H3/b8-6+/t9-,14+/m0/s1 |
| InChIKey | MZNXCQWXVAGCJY-GZUDJTKDSA-N |
| XLogP | 1.80 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | 435 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|