C17H22O6 — CID 73353794
methyl 2-[(2R,4Z)-4-[(5R)-5-methyl-5-[(2R)-2-methylbutyl]furan-2-ylidene]-3,5-dioxooxolan-2-yl]acetate (PubChem CID 73353794) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl 2-[(2R,4Z)-4-[(5R)-5-methyl-5-[(2R)-2-methylbutyl]furan-2-ylidene]-3,5-dioxooxolan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,4Z)-4-[(5R)-5-methyl-5-[(2R)-2-methylbutyl]furan-2-ylidene]-3,5-dioxooxolan-2-yl]acetate |
|---|---|
| PubChem CID | 73353794 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | methyl 2-[(2R,4Z)-4-[(5R)-5-methyl-5-[(2R)-2-methylbutyl]furan-2-ylidene]-3,5-dioxooxolan-2-yl]acetate |
| SMILES | CC[C@@H](C)C[C@]1(C)C=C/C(=C2/C(=O)O[C@H](CC(=O)OC)C2=O)O1 |
| InChI | InChI=1S/C17H22O6/c1-5-10(2)9-17(3)7-6-11(23-17)14-15(19)12(22-16(14)20)8-13(18)21-4/h6-7,10,12H,5,8-9H2,1-4H3/b14-11-/t10-,12-,17+/m1/s1 |
| InChIKey | WINHGWXNBYXACQ-NBDPGLAOSA-N |
| XLogP | 2.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|