C19H26O5 — CID 54309957
[(1S)-1-(2,4-dioxooxolan-3-yl)-6,6-dimethyl-3-(2-methylpropyl)cyclohexa-2,4-dien-1-yl] propanoate (PubChem CID 54309957) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is [(1S)-1-(2,4-dioxooxolan-3-yl)-6,6-dimethyl-3-(2-methylpropyl)cyclohexa-2,4-dien-1-yl] propanoate.
| Compound Name | [(1S)-1-(2,4-dioxooxolan-3-yl)-6,6-dimethyl-3-(2-methylpropyl)cyclohexa-2,4-dien-1-yl] propanoate |
|---|---|
| PubChem CID | 54309957 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(1S)-1-(2,4-dioxooxolan-3-yl)-6,6-dimethyl-3-(2-methylpropyl)cyclohexa-2,4-dien-1-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C2C(=O)COC2=O)C=C(CC(C)C)C=CC1(C)C |
| InChI | InChI=1S/C19H26O5/c1-6-15(21)24-19(16-14(20)11-23-17(16)22)10-13(9-12(2)3)7-8-18(19,4)5/h7-8,10,12,16H,6,9,11H2,1-5H3/t16?,19-/m0/s1 |
| InChIKey | SKEDJEQWOOIOJP-CVMIBEPCSA-N |
| XLogP | 2.99 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|