C16H20O4 — CID 166126824
methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-prop-1-enyl]furan-3-carboxylate (PubChem CID 166126824) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-prop-1-enyl]furan-3-carboxylate.
| Compound Name | methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-prop-1-enyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 166126824 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | methyl 5-[(1E,3E)-hexa-1,3-dienyl]-5-methyl-4-oxo-2-[(E)-prop-1-enyl]furan-3-carboxylate |
| SMILES | C/C=C/C1=C(C(=O)OC)C(=O)C(C)(/C=C/C=C/CC)O1 |
| InChI | InChI=1S/C16H20O4/c1-5-7-8-9-11-16(3)14(17)13(15(18)19-4)12(20-16)10-6-2/h6-11H,5H2,1-4H3/b8-7+,10-6+,11-9+ |
| InChIKey | KRKRNFJPWDGGGZ-AIQQMXLGSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|