C15H15FN6O2 — CID 140723831
1-[3-cyclopropyl-5-fluoro-2-(1H-pyrazol-5-yloxymethyl)phenyl]-4-methyltetrazol-5-one (PubChem CID 140723831) has the molecular formula C15H15FN6O2 and a molecular weight of 330.32 g/mol. Its IUPAC name is 1-[3-cyclopropyl-5-fluoro-2-(1H-pyrazol-5-yloxymethyl)phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[3-cyclopropyl-5-fluoro-2-(1H-pyrazol-5-yloxymethyl)phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 140723831 |
| Molecular Formula | C15H15FN6O2 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-[3-cyclopropyl-5-fluoro-2-(1H-pyrazol-5-yloxymethyl)phenyl]-4-methyltetrazol-5-one |
| SMILES | Cn1nnn(-c2cc(F)cc(C3CC3)c2COc2ccn[nH]2)c1=O |
| InChI | InChI=1S/C15H15FN6O2/c1-21-15(23)22(20-19-21)13-7-10(16)6-11(9-2-3-9)12(13)8-24-14-4-5-17-18-14/h4-7,9H,2-3,8H2,1H3,(H,17,18) |
| InChIKey | JGLJCFNIHPSGLB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |