C19H17BrN2O5 — CID 1407266
[4-[(E)-2-cyano-3-oxo-3-(propan-2-ylamino)prop-1-enyl]-2-methoxyphenyl] 5-bromofuran-2-carboxylate (PubChem CID 1407266) has the molecular formula C19H17BrN2O5 and a molecular weight of 433.26 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-oxo-3-(propan-2-ylamino)prop-1-enyl]-2-methoxyphenyl] 5-bromofuran-2-carboxylate.
| Compound Name | [4-[(E)-2-cyano-3-oxo-3-(propan-2-ylamino)prop-1-enyl]-2-methoxyphenyl] 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 1407266 |
| Molecular Formula | C19H17BrN2O5 |
| Molecular Weight | 433.26 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | [4-[(E)-2-cyano-3-oxo-3-(propan-2-ylamino)prop-1-enyl]-2-methoxyphenyl] 5-bromofuran-2-carboxylate |
| SMILES | COc1cc(/C=C(\C#N)C(=O)NC(C)C)ccc1OC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C19H17BrN2O5/c1-11(2)22-18(23)13(10-21)8-12-4-5-14(16(9-12)25-3)27-19(24)15-6-7-17(20)26-15/h4-9,11H,1-3H3,(H,22,23)/b13-8+ |
| InChIKey | LBWIUTNSDMNMSR-MDWZMJQESA-N |
| XLogP | 3.70 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|