C18H29N3O2S2 — CID 140731671
N-[2-(thiomorpholine-4-carbonyl)cyclopentyl]-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole-2-carboxamide (PubChem CID 140731671) has the molecular formula C18H29N3O2S2 and a molecular weight of 383.58 g/mol. Its IUPAC name is N-[2-(thiomorpholine-4-carbonyl)cyclopentyl]-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[2-(thiomorpholine-4-carbonyl)cyclopentyl]-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 140731671 |
| Molecular Formula | C18H29N3O2S2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-[2-(thiomorpholine-4-carbonyl)cyclopentyl]-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(NC1CCCC1C(=O)N1CCSCC1)C1NC2CCCCC2S1 |
| InChI | InChI=1S/C18H29N3O2S2/c22-16(17-20-14-5-1-2-7-15(14)25-17)19-13-6-3-4-12(13)18(23)21-8-10-24-11-9-21/h12-15,17,20H,1-11H2,(H,19,22) |
| InChIKey | IWKNOAHUUOTLIT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |