C24H39N3O3S2 — CID 140731596
N-[5-cyclohexyl-4-methyl-3-(morpholine-4-carbonyl)thiolan-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole-2-carboxamide (PubChem CID 140731596) has the molecular formula C24H39N3O3S2 and a molecular weight of 481.73 g/mol. Its IUPAC name is N-[5-cyclohexyl-4-methyl-3-(morpholine-4-carbonyl)thiolan-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-[5-cyclohexyl-4-methyl-3-(morpholine-4-carbonyl)thiolan-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 140731596 |
| Molecular Formula | C24H39N3O3S2 |
| Molecular Weight | 481.73 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | N-[5-cyclohexyl-4-methyl-3-(morpholine-4-carbonyl)thiolan-2-yl]-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzothiazole-2-carboxamide |
| SMILES | CC1C(C2CCCCC2)SC(NC(=O)C2NC3CCCCC3S2)C1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H39N3O3S2/c1-15-19(24(29)27-11-13-30-14-12-27)22(32-20(15)16-7-3-2-4-8-16)26-21(28)23-25-17-9-5-6-10-18(17)31-23/h15-20,22-23,25H,2-14H2,1H3,(H,26,28) |
| InChIKey | BCGAYLMTAXNQPI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.73 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |