About CID 140732481
CID 140732481 (PubChem CID 140732481) has the molecular formula C7H14BN2O
and a molecular weight of 153.01 g/mol.
Molecular Properties
| Compound Name | CID 140732481 |
| PubChem CID | 140732481 |
| Molecular Formula | C7H14BN2O |
| Molecular Weight | 153.01 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | — |
| SMILES | NCC1CCCCN1[B]C=O |
| InChI | InChI=1S/C7H14BN2O/c9-5-7-3-1-2-4-10(7)8-6-11/h6-7H,1-5,9H2 |
| InChIKey | IQNATLRTPOIXSJ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.01 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140732481 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140732481?
The IUPAC name of CID 140732481 (CID 140732481) is not available.
What is the SMILES notation for CID 140732481?
The canonical SMILES for CID 140732481 is NCC1CCCCN1[B]C=O.
What is the InChIKey of CID 140732481?
The InChIKey is IQNATLRTPOIXSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BN2O/c9-5-7-3-1-2-4-10(7)8-6-11/h6-7H,1-5,9H2.
What are the key properties of CID 140732481?
CID 140732481 has a molecular weight of 153.01 g/mol, XLogP of -0.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140732481 is sourced from PubChem (CID 140732481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).