C9H12O5-2 — CID 140732737
4-methoxycyclohexane-1,1-dicarboxylate (PubChem CID 140732737) has the molecular formula C9H12O5-2 and a molecular weight of 200.19 g/mol. Its IUPAC name is 4-methoxycyclohexane-1,1-dicarboxylate.
| Compound Name | 4-methoxycyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 140732737 |
| Molecular Formula | C9H12O5-2 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 4-methoxycyclohexane-1,1-dicarboxylate |
| SMILES | COC1CCC(C(=O)[O-])(C(=O)[O-])CC1 |
| InChI | InChI=1S/C9H14O5/c1-14-6-2-4-9(5-3-6,7(10)11)8(12)13/h6H,2-5H2,1H3,(H,10,11)(H,12,13)/p-2 |
| InChIKey | KQRSIWKHMBCDQA-UHFFFAOYSA-L |
| XLogP | -1.94 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|