C15H14ClN2O3- — CID 140735620
6-[4-[(2R)-butan-2-yl]oxy-3-chlorophenyl]pyrimidine-4-carboxylate (PubChem CID 140735620) has the molecular formula C15H14ClN2O3- and a molecular weight of 305.74 g/mol. Its IUPAC name is 6-[4-[(2R)-butan-2-yl]oxy-3-chlorophenyl]pyrimidine-4-carboxylate.
| Compound Name | 6-[4-[(2R)-butan-2-yl]oxy-3-chlorophenyl]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 140735620 |
| Molecular Formula | C15H14ClN2O3- |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 6-[4-[(2R)-butan-2-yl]oxy-3-chlorophenyl]pyrimidine-4-carboxylate |
| SMILES | CC[C@@H](C)Oc1ccc(-c2cc(C(=O)[O-])ncn2)cc1Cl |
| InChI | InChI=1S/C15H15ClN2O3/c1-3-9(2)21-14-5-4-10(6-11(14)16)12-7-13(15(19)20)18-8-17-12/h4-9H,3H2,1-2H3,(H,19,20)/p-1/t9-/m1/s1 |
| InChIKey | PSOBNYRYPKZAFV-SECBINFHSA-M |
| XLogP | 2.34 |
| TPSA | 75.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |