C14H28N2O2 — CID 140737739
[(2S,3S)-3-propan-2-ylpiperidin-2-yl]methyl N-tert-butylcarbamate (PubChem CID 140737739) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is [(2S,3S)-3-propan-2-ylpiperidin-2-yl]methyl N-tert-butylcarbamate.
| Compound Name | [(2S,3S)-3-propan-2-ylpiperidin-2-yl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 140737739 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | [(2S,3S)-3-propan-2-ylpiperidin-2-yl]methyl N-tert-butylcarbamate |
| SMILES | CC(C)[C@@H]1CCCN[C@@H]1COC(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H28N2O2/c1-10(2)11-7-6-8-15-12(11)9-18-13(17)16-14(3,4)5/h10-12,15H,6-9H2,1-5H3,(H,16,17)/t11-,12+/m0/s1 |
| InChIKey | AZURLLHZCHLJAG-NWDGAFQWSA-N |
| XLogP | 2.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |