C63H72N2Si2 — CID 140738045
7-N,7-N,17-N,17-N-tetrakis(4-propan-2-ylphenyl)-12,12-bis(trimethylsilyl)pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-7,17-diamine (PubChem CID 140738045) has the molecular formula C63H72N2Si2 and a molecular weight of 913.46 g/mol. Its IUPAC name is 7-N,7-N,17-N,17-N-tetrakis(4-propan-2-ylphenyl)-12,12-bis(trimethylsilyl)pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-7,17-diamine.
| Compound Name | 7-N,7-N,17-N,17-N-tetrakis(4-propan-2-ylphenyl)-12,12-bis(trimethylsilyl)pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-7,17-diamine |
|---|---|
| PubChem CID | 140738045 |
| Molecular Formula | C63H72N2Si2 |
| Molecular Weight | 913.46 g/mol |
| Exact Mass | 912.52 |
| IUPAC Name | 7-N,7-N,17-N,17-N-tetrakis(4-propan-2-ylphenyl)-12,12-bis(trimethylsilyl)pentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-7,17-diamine |
| SMILES | CC(C)c1ccc(N(c2ccc(C(C)C)cc2)c2ccc3cc4c(cc3c2)C([Si](C)(C)C)([Si](C)(C)C)c2cc3cc(N(c5ccc(C(C)C)cc5)c5ccc(C(C)C)cc5)ccc3cc2-4)cc1 |
| InChI | InChI=1S/C63H72N2Si2/c1-41(2)45-15-25-53(26-16-45)64(54-27-17-46(18-28-54)42(3)4)57-33-23-49-37-59-60-38-50-24-34-58(65(55-29-19-47(20-30-55)43(5)6)56-31-21-48(22-32-56)44(7)8)36-52(50)40-62(60)63(66(9,10)11,67(12,13)14)61(59)39-51(49)35-57/h15-44H,1-14H3 |
| InChIKey | VWMLSYRPOZXDKU-UHFFFAOYSA-N |
| XLogP | 19.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.46 |
| LogP ≤ 5 | 19.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|