C71H86N2Si2 — CID 140738112
2-N,2-N,8-N,8-N-tetrakis(4-cyclohexylphenyl)-11,11-bis(trimethylsilyl)benzo[b]fluorene-2,8-diamine (PubChem CID 140738112) has the molecular formula C71H86N2Si2 and a molecular weight of 1023.65 g/mol. Its IUPAC name is 2-N,2-N,8-N,8-N-tetrakis(4-cyclohexylphenyl)-11,11-bis(trimethylsilyl)benzo[b]fluorene-2,8-diamine.
| Compound Name | 2-N,2-N,8-N,8-N-tetrakis(4-cyclohexylphenyl)-11,11-bis(trimethylsilyl)benzo[b]fluorene-2,8-diamine |
|---|---|
| PubChem CID | 140738112 |
| Molecular Formula | C71H86N2Si2 |
| Molecular Weight | 1023.65 g/mol |
| Exact Mass | 1022.63 |
| IUPAC Name | 2-N,2-N,8-N,8-N-tetrakis(4-cyclohexylphenyl)-11,11-bis(trimethylsilyl)benzo[b]fluorene-2,8-diamine |
| SMILES | C[Si](C)(C)C1([Si](C)(C)C)c2cc(N(c3ccc(C4CCCCC4)cc3)c3ccc(C4CCCCC4)cc3)ccc2-c2cc3ccc(N(c4ccc(C5CCCCC5)cc4)c4ccc(C5CCCCC5)cc4)cc3cc21 |
| InChI | InChI=1S/C71H86N2Si2/c1-74(2,3)71(75(4,5)6)69-49-60-47-65(72(61-36-27-55(28-37-61)51-19-11-7-12-20-51)62-38-29-56(30-39-62)52-21-13-8-14-22-52)44-35-59(60)48-68(69)67-46-45-66(50-70(67)71)73(63-40-31-57(32-41-63)53-23-15-9-16-24-53)64-42-33-58(34-43-64)54-25-17-10-18-26-54/h27-54H,7-26H2,1-6H3 |
| InChIKey | ZGFGPGHLQCKDOD-UHFFFAOYSA-N |
| XLogP | 21.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.65 |
| LogP ≤ 5 | 21.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|