C53H52N2Si2 — CID 140738191
7-N,17-N-bis(2-methylphenyl)-7-N,17-N-diphenyl-12,12-bis(trimethylsilyl)pentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5(10),6,8,14(19),15,17,20-decaene-7,17-diamine (PubChem CID 140738191) has the molecular formula C53H52N2Si2 and a molecular weight of 773.19 g/mol. Its IUPAC name is 7-N,17-N-bis(2-methylphenyl)-7-N,17-N-diphenyl-12,12-bis(trimethylsilyl)pentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5(10),6,8,14(19),15,17,20-decaene-7,17-diamine.
| Compound Name | 7-N,17-N-bis(2-methylphenyl)-7-N,17-N-diphenyl-12,12-bis(trimethylsilyl)pentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5(10),6,8,14(19),15,17,20-decaene-7,17-diamine |
|---|---|
| PubChem CID | 140738191 |
| Molecular Formula | C53H52N2Si2 |
| Molecular Weight | 773.19 g/mol |
| Exact Mass | 772.37 |
| IUPAC Name | 7-N,17-N-bis(2-methylphenyl)-7-N,17-N-diphenyl-12,12-bis(trimethylsilyl)pentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5(10),6,8,14(19),15,17,20-decaene-7,17-diamine |
| SMILES | Cc1ccccc1N(c1ccccc1)c1ccc2c3c(ccc2c1)-c1ccc2cc(N(c4ccccc4)c4ccccc4C)ccc2c1C3([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C53H52N2Si2/c1-37-19-15-17-25-49(37)54(41-21-11-9-12-22-41)43-29-33-45-39(35-43)27-31-47-48-32-28-40-36-44(55(42-23-13-10-14-24-42)50-26-18-16-20-38(50)2)30-34-46(40)52(48)53(51(45)47,56(3,4)5)57(6,7)8/h9-36H,1-8H3 |
| InChIKey | QEDJSWIVGXQOIV-UHFFFAOYSA-N |
| XLogP | 15.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.19 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|