C71H62N2Si2 — CID 140738244
3-N,9-N-bis(2,4-diphenylphenyl)-3-N,9-N-diphenyl-11,11-bis(trimethylsilyl)benzo[a]fluorene-3,9-diamine (PubChem CID 140738244) has the molecular formula C71H62N2Si2 and a molecular weight of 999.46 g/mol. Its IUPAC name is 3-N,9-N-bis(2,4-diphenylphenyl)-3-N,9-N-diphenyl-11,11-bis(trimethylsilyl)benzo[a]fluorene-3,9-diamine.
| Compound Name | 3-N,9-N-bis(2,4-diphenylphenyl)-3-N,9-N-diphenyl-11,11-bis(trimethylsilyl)benzo[a]fluorene-3,9-diamine |
|---|---|
| PubChem CID | 140738244 |
| Molecular Formula | C71H62N2Si2 |
| Molecular Weight | 999.46 g/mol |
| Exact Mass | 998.45 |
| IUPAC Name | 3-N,9-N-bis(2,4-diphenylphenyl)-3-N,9-N-diphenyl-11,11-bis(trimethylsilyl)benzo[a]fluorene-3,9-diamine |
| SMILES | C[Si](C)(C)C1([Si](C)(C)C)c2cc(N(c3ccccc3)c3ccc(-c4ccccc4)cc3-c3ccccc3)ccc2-c2ccc3cc(N(c4ccccc4)c4ccc(-c5ccccc5)cc4-c4ccccc4)ccc3c21 |
| InChI | InChI=1S/C71H62N2Si2/c1-74(2,3)71(75(4,5)6)67-50-61(73(59-35-23-12-24-36-59)69-46-39-56(52-27-15-8-16-28-52)49-66(69)54-31-19-10-20-32-54)41-44-63(67)64-42-37-57-47-60(40-43-62(57)70(64)71)72(58-33-21-11-22-34-58)68-45-38-55(51-25-13-7-14-26-51)48-65(68)53-29-17-9-18-30-53/h7-50H,1-6H3 |
| InChIKey | CTMOSNIPMAVSIL-UHFFFAOYSA-N |
| XLogP | 20.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.46 |
| LogP ≤ 5 | 20.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|