C49H50N2Si2 — CID 140738274
5-N,9-N-bis(3-methylphenyl)-5-N,9-N-diphenyl-7,7-bis(trimethylsilyl)benzo[c]fluorene-5,9-diamine (PubChem CID 140738274) has the molecular formula C49H50N2Si2 and a molecular weight of 723.13 g/mol. Its IUPAC name is 5-N,9-N-bis(3-methylphenyl)-5-N,9-N-diphenyl-7,7-bis(trimethylsilyl)benzo[c]fluorene-5,9-diamine.
| Compound Name | 5-N,9-N-bis(3-methylphenyl)-5-N,9-N-diphenyl-7,7-bis(trimethylsilyl)benzo[c]fluorene-5,9-diamine |
|---|---|
| PubChem CID | 140738274 |
| Molecular Formula | C49H50N2Si2 |
| Molecular Weight | 723.13 g/mol |
| Exact Mass | 722.35 |
| IUPAC Name | 5-N,9-N-bis(3-methylphenyl)-5-N,9-N-diphenyl-7,7-bis(trimethylsilyl)benzo[c]fluorene-5,9-diamine |
| SMILES | Cc1cccc(N(c2ccccc2)c2ccc3c(c2)C([Si](C)(C)C)([Si](C)(C)C)c2cc(N(c4ccccc4)c4cccc(C)c4)c4ccccc4c2-3)c1 |
| InChI | InChI=1S/C49H50N2Si2/c1-35-19-17-25-39(31-35)50(37-21-11-9-12-22-37)41-29-30-44-45(33-41)49(52(3,4)5,53(6,7)8)46-34-47(42-27-15-16-28-43(42)48(44)46)51(38-23-13-10-14-24-38)40-26-18-20-36(2)32-40/h9-34H,1-8H3 |
| InChIKey | YMNIDNKYJWETAT-UHFFFAOYSA-N |
| XLogP | 14.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.13 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|