C55H56N2Si2 — CID 140738201
9-N,15-N-bis(2,4-dimethylphenyl)-9-N,15-N-diphenyl-12,12-bis(trimethylsilyl)pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-9,15-diamine (PubChem CID 140738201) has the molecular formula C55H56N2Si2 and a molecular weight of 801.24 g/mol. Its IUPAC name is 9-N,15-N-bis(2,4-dimethylphenyl)-9-N,15-N-diphenyl-12,12-bis(trimethylsilyl)pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-9,15-diamine.
| Compound Name | 9-N,15-N-bis(2,4-dimethylphenyl)-9-N,15-N-diphenyl-12,12-bis(trimethylsilyl)pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-9,15-diamine |
|---|---|
| PubChem CID | 140738201 |
| Molecular Formula | C55H56N2Si2 |
| Molecular Weight | 801.24 g/mol |
| Exact Mass | 800.40 |
| IUPAC Name | 9-N,15-N-bis(2,4-dimethylphenyl)-9-N,15-N-diphenyl-12,12-bis(trimethylsilyl)pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-9,15-diamine |
| SMILES | Cc1ccc(N(c2ccccc2)c2cc3c(c4ccccc24)-c2c(cc(N(c4ccccc4)c4ccc(C)cc4C)c4ccccc24)C3([Si](C)(C)C)[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C55H56N2Si2/c1-37-29-31-49(39(3)33-37)56(41-21-13-11-14-22-41)51-35-47-53(45-27-19-17-25-43(45)51)54-46-28-20-18-26-44(46)52(36-48(54)55(47,58(5,6)7)59(8,9)10)57(42-23-15-12-16-24-42)50-32-30-38(2)34-40(50)4/h11-36H,1-10H3 |
| InChIKey | WMVOYIUCJRHSPF-UHFFFAOYSA-N |
| XLogP | 16.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.24 |
| LogP ≤ 5 | 16.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|