C44H51N — CID 145100492
N,N-bis(2,4-dimethylphenyl)-3,3,11,11-tetramethylpentacyclo[10.8.0.02,10.04,9.015,20]icosa-1(12),2(10),4,6,8,13,15,17,19-nonaen-14-amine;ethane (PubChem CID 145100492) has the molecular formula C44H51N and a molecular weight of 593.90 g/mol. Its IUPAC name is N,N-bis(2,4-dimethylphenyl)-3,3,11,11-tetramethylpentacyclo[10.8.0.02,10.04,9.015,20]icosa-1(12),2(10),4,6,8,13,15,17,19-nonaen-14-amine;ethane.
| Compound Name | N,N-bis(2,4-dimethylphenyl)-3,3,11,11-tetramethylpentacyclo[10.8.0.02,10.04,9.015,20]icosa-1(12),2(10),4,6,8,13,15,17,19-nonaen-14-amine;ethane |
|---|---|
| PubChem CID | 145100492 |
| Molecular Formula | C44H51N |
| Molecular Weight | 593.90 g/mol |
| Exact Mass | 593.40 |
| IUPAC Name | N,N-bis(2,4-dimethylphenyl)-3,3,11,11-tetramethylpentacyclo[10.8.0.02,10.04,9.015,20]icosa-1(12),2(10),4,6,8,13,15,17,19-nonaen-14-amine;ethane |
| SMILES | CC.CC.Cc1ccc(N(c2ccc(C)cc2C)c2cc3c(c4ccccc24)C2=C(c4ccccc4C2(C)C)C3(C)C)c(C)c1 |
| InChI | InChI=1S/C40H39N.2C2H6/c1-24-17-19-33(26(3)21-24)41(34-20-18-25(2)22-27(34)4)35-23-32-36(29-14-10-9-13-28(29)35)38-37(40(32,7)8)30-15-11-12-16-31(30)39(38,5)6;2*1-2/h9-23H,1-8H3;2*1-2H3 |
| InChIKey | QJBRBNLVSZASNE-UHFFFAOYSA-N |
| XLogP | 13.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.90 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|