C24H23ClN7O — CID 140738426
CID 140738426 (PubChem CID 140738426) has the molecular formula C24H23ClN7O and a molecular weight of 460.95 g/mol.
| Compound Name | CID 140738426 |
|---|---|
| PubChem CID | 140738426 |
| Molecular Formula | C24H23ClN7O |
| Molecular Weight | 460.95 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | — |
| SMILES | [NH]c1ccc(C(=O)N[C@H]2CCC[C@@H](Nc3ncc(Cl)c(-c4cnn5ccccc45)n3)C2)cc1 |
| InChI | InChI=1S/C24H23ClN7O/c25-20-14-27-24(31-22(20)19-13-28-32-11-2-1-6-21(19)32)30-18-5-3-4-17(12-18)29-23(33)15-7-9-16(26)10-8-15/h1-2,6-11,13-14,17-18,26H,3-5,12H2,(H,29,33)(H,27,30,31)/t17-,18+/m0/s1 |
| InChIKey | KTDHFXHGBQBMPX-ZWKOTPCHSA-N |
| XLogP | 4.51 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.95 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |