C13H19N2O3Y- — CID 140738693
(4-methylpiperazin-1-yl)-[3-(oxomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanone;yttrium (PubChem CID 140738693) has the molecular formula C13H19N2O3Y- and a molecular weight of 340.21 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[3-(oxomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanone;yttrium.
| Compound Name | (4-methylpiperazin-1-yl)-[3-(oxomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanone;yttrium |
|---|---|
| PubChem CID | 140738693 |
| Molecular Formula | C13H19N2O3Y- |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[3-(oxomethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanone;yttrium |
| SMILES | CN1CCN(C(=O)C2C3CCC(O3)C2[C-]=O)CC1.[Y] |
| InChI | InChI=1S/C13H19N2O3.Y/c1-14-4-6-15(7-5-14)13(17)12-9(8-16)10-2-3-11(12)18-10;/h9-12H,2-7H2,1H3;/q-1; |
| InChIKey | IJXJYTLEARHCBL-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|